C20H19IN2O4 — CID 10743262
ethyl 3-(7-iodo-2,5-dioxo-3-phenyl-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate (PubChem CID 10743262) has the molecular formula C20H19IN2O4 and a molecular weight of 478.29 g/mol. Its IUPAC name is ethyl 3-(7-iodo-2,5-dioxo-3-phenyl-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate.
| Compound Name | ethyl 3-(7-iodo-2,5-dioxo-3-phenyl-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate |
|---|---|
| PubChem CID | 10743262 |
| Molecular Formula | C20H19IN2O4 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | ethyl 3-(7-iodo-2,5-dioxo-3-phenyl-1,3-dihydro-1,4-benzodiazepin-4-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)c2cc(I)ccc2NC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C20H19IN2O4/c1-2-27-17(24)10-11-23-18(13-6-4-3-5-7-13)19(25)22-16-9-8-14(21)12-15(16)20(23)26/h3-9,12,18H,2,10-11H2,1H3,(H,22,25) |
| InChIKey | QTVUXBHVXKKQSI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|