C33H38OSi — CID 10743291
[5-(2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl)-2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl]oxy-trimethylsilane (PubChem CID 10743291) has the molecular formula C33H38OSi and a molecular weight of 478.75 g/mol. Its IUPAC name is [5-(2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl)-2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl]oxy-trimethylsilane.
| Compound Name | [5-(2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl)-2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10743291 |
| Molecular Formula | C33H38OSi |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [5-(2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl)-2,3,4,7,8,9-hexahydro-1H-cyclopenta[e]-as-indacen-6-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=C(C2=CCc3c4c(c5c(c32)CCC5)CCC4)Cc2c3c(c4c(c21)CCC4)CCC3 |
| InChI | InChI=1S/C33H38OSi/c1-35(2,3)34-33-30(18-29-24-13-5-9-20(24)22-12-7-15-26(22)32(29)33)28-17-16-27-23-10-4-8-19(23)21-11-6-14-25(21)31(27)28/h17H,4-16,18H2,1-3H3 |
| InChIKey | DISVKZJGXYDHOS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|