C10H16N2O4S — CID 107432944
5-oxo-1-(2-propan-2-ylsulfanylacetyl)piperazine-2-carboxylic acid (PubChem CID 107432944) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 5-oxo-1-(2-propan-2-ylsulfanylacetyl)piperazine-2-carboxylic acid.
| Compound Name | 5-oxo-1-(2-propan-2-ylsulfanylacetyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107432944 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-oxo-1-(2-propan-2-ylsulfanylacetyl)piperazine-2-carboxylic acid |
| SMILES | CC(C)SCC(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C10H16N2O4S/c1-6(2)17-5-9(14)12-4-8(13)11-3-7(12)10(15)16/h6-7H,3-5H2,1-2H3,(H,11,13)(H,15,16) |
| InChIKey | BZFLFGWEBZCECL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |