About 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid
1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107433030) has the molecular formula C10H8Cl2N4O4
and a molecular weight of 319.10 g/mol. Its IUPAC name is 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| PubChem CID | 107433030 |
| Molecular Formula | C10H8Cl2N4O4 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)c2cc(Cl)nnc2Cl)C(C(=O)O)CN1 |
| InChI | InChI=1S/C10H8Cl2N4O4/c11-6-1-4(8(12)15-14-6)9(18)16-3-7(17)13-2-5(16)10(19)20/h1,5H,2-3H2,(H,13,17)(H,19,20) |
| InChIKey | ZNSSENXHRFVRIM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid?
The IUPAC name of 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid (CID 107433030) is 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid.
What is the SMILES notation for 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid?
The canonical SMILES for 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid is O=C1CN(C(=O)c2cc(Cl)nnc2Cl)C(C(=O)O)CN1.
What is the InChIKey of 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid?
The InChIKey is ZNSSENXHRFVRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N4O4/c11-6-1-4(8(12)15-14-6)9(18)16-3-7(17)13-2-5(16)10(19)20/h1,5H,2-3H2,(H,13,17)(H,19,20).
What are the key properties of 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid?
1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid has a molecular weight of 319.10 g/mol, XLogP of -0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dichloropyridazine-4-carbonyl)-5-oxopiperazine-2-carboxylic acid is sourced from PubChem (CID 107433030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).