About 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid
5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid (PubChem CID 107433194) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid |
| PubChem CID | 107433194 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid |
| SMILES | Cc1oc(C)c(C(=O)N2CC(=O)NCC2C(=O)O)c1C |
| InChI | InChI=1S/C13H16N2O5/c1-6-7(2)20-8(3)11(6)12(17)15-5-10(16)14-4-9(15)13(18)19/h9H,4-5H2,1-3H3,(H,14,16)(H,18,19) |
| InChIKey | KNIDYUXWJNWWKQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid?
The IUPAC name of 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid (CID 107433194) is 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid.
What is the SMILES notation for 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid?
The canonical SMILES for 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid is Cc1oc(C)c(C(=O)N2CC(=O)NCC2C(=O)O)c1C.
What is the InChIKey of 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid?
The InChIKey is KNIDYUXWJNWWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O5/c1-6-7(2)20-8(3)11(6)12(17)15-5-10(16)14-4-9(15)13(18)19/h9H,4-5H2,1-3H3,(H,14,16)(H,18,19).
What are the key properties of 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid?
5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid has a molecular weight of 280.28 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1-(2,4,5-trimethylfuran-3-carbonyl)piperazine-2-carboxylic acid is sourced from PubChem (CID 107433194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).