C28H27N5O3 — CID 10743384
[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] pyridine-3-carboxylate (PubChem CID 10743384) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] pyridine-3-carboxylate.
| Compound Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10743384 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] pyridine-3-carboxylate |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)c4cccnc4)ccc3n(C)c12 |
| InChI | InChI=1S/C28H27N5O3/c1-17-20-9-11-30-25(27(34)31-12-13-32(2)3)22(20)15-23-21-14-19(7-8-24(21)33(4)26(17)23)36-28(35)18-6-5-10-29-16-18/h5-11,14-16H,12-13H2,1-4H3,(H,31,34) |
| InChIKey | ITINPRIVPMWHGG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|