C27H33NO7 — CID 10743442
benzyl N-[(2R)-1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-oxobutan-2-yl]-N-benzylcarbamate (PubChem CID 10743442) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-oxobutan-2-yl]-N-benzylcarbamate.
| Compound Name | benzyl N-[(2R)-1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-oxobutan-2-yl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 10743442 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | benzyl N-[(2R)-1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-oxobutan-2-yl]-N-benzylcarbamate |
| SMILES | CO[C@@H]1O[C@H](C[C@H](CC=O)N(Cc2ccccc2)C(=O)OCc2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C27H33NO7/c1-27(2)34-23-22(33-25(31-3)24(23)35-27)16-21(14-15-29)28(17-19-10-6-4-7-11-19)26(30)32-18-20-12-8-5-9-13-20/h4-13,15,21-25H,14,16-18H2,1-3H3/t21-,22+,23+,24+,25+/m0/s1 |
| InChIKey | KGDUSDUEMBJGJO-XTAUHMBVSA-N |
| XLogP | 4.06 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|