About 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid
2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid (PubChem CID 107434591) has the molecular formula C10H12N4O5S
and a molecular weight of 300.30 g/mol. Its IUPAC name is 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid |
| PubChem CID | 107434591 |
| Molecular Formula | C10H12N4O5S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid |
| SMILES | CC(=O)Nc1nc(C(=O)N(CC(N)=O)CC(=O)O)cs1 |
| InChI | InChI=1S/C10H12N4O5S/c1-5(15)12-10-13-6(4-20-10)9(19)14(2-7(11)16)3-8(17)18/h4H,2-3H2,1H3,(H2,11,16)(H,17,18)(H,12,13,15) |
| InChIKey | FPSMGZNLLWMUAM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid?
The IUPAC name of 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid (CID 107434591) is 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid.
What is the SMILES notation for 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid?
The canonical SMILES for 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid is CC(=O)Nc1nc(C(=O)N(CC(N)=O)CC(=O)O)cs1.
What is the InChIKey of 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid?
The InChIKey is FPSMGZNLLWMUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O5S/c1-5(15)12-10-13-6(4-20-10)9(19)14(2-7(11)16)3-8(17)18/h4H,2-3H2,1H3,(H2,11,16)(H,17,18)(H,12,13,15).
What are the key properties of 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid?
2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid has a molecular weight of 300.30 g/mol, XLogP of -0.89, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-acetamido-1,3-thiazole-4-carbonyl)-(2-amino-2-oxoethyl)amino]acetic acid is sourced from PubChem (CID 107434591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).