C18H22IN3O3S — CID 10743500
4-(125I)iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide (PubChem CID 10743500) has the molecular formula C18H22IN3O3S and a molecular weight of 485.36 g/mol. Its IUPAC name is 4-(125I)iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-(125I)iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10743500 |
| Molecular Formula | C18H22IN3O3S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 4-(125I)iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc([125I])cc2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C18H22IN3O3S/c1-21-9-11-22(12-10-21)17-13-15(5-8-18(17)25-2)20-26(23,24)16-6-3-14(19)4-7-16/h3-8,13,20H,9-12H2,1-2H3/i19-2 |
| InChIKey | BDHMSYNBSBZCAF-GBVACIEGSA-N |
| XLogP | 2.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|