C28H39NO6 — CID 10743515
[(1S,3E,5S,6R,9E,11S,14S,15R,16S)-5-acetyloxy-9,13,14-trimethyl-16-(2-methylpropyl)-2,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-6-yl] acetate (PubChem CID 10743515) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is [(1S,3E,5S,6R,9E,11S,14S,15R,16S)-5-acetyloxy-9,13,14-trimethyl-16-(2-methylpropyl)-2,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-6-yl] acetate.
| Compound Name | [(1S,3E,5S,6R,9E,11S,14S,15R,16S)-5-acetyloxy-9,13,14-trimethyl-16-(2-methylpropyl)-2,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-6-yl] acetate |
|---|---|
| PubChem CID | 10743515 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | [(1S,3E,5S,6R,9E,11S,14S,15R,16S)-5-acetyloxy-9,13,14-trimethyl-16-(2-methylpropyl)-2,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/C(=O)[C@@]23C(=O)N[C@@H](CC(C)C)[C@@H]2[C@H](C)C(C)=C[C@@H]3/C=C(\C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H39NO6/c1-15(2)12-22-26-18(5)17(4)14-21-13-16(3)8-9-23(34-19(6)30)24(35-20(7)31)10-11-25(32)28(21,26)27(33)29-22/h10-11,13-15,18,21-24,26H,8-9,12H2,1-7H3,(H,29,33)/b11-10+,16-13+/t18-,21+,22+,23-,24+,26+,28-/m1/s1 |
| InChIKey | HRURGVWLTOSBPC-MQXVAIJUSA-N |
| XLogP | 4.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|