C11H15N3O2S — CID 107436034
5-oxo-N-(2-thiophen-3-ylethyl)piperazine-2-carboxamide (PubChem CID 107436034) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-oxo-N-(2-thiophen-3-ylethyl)piperazine-2-carboxamide.
| Compound Name | 5-oxo-N-(2-thiophen-3-ylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 107436034 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-oxo-N-(2-thiophen-3-ylethyl)piperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)NCCc2ccsc2)CN1 |
| InChI | InChI=1S/C11H15N3O2S/c15-10-6-13-9(5-14-10)11(16)12-3-1-8-2-4-17-7-8/h2,4,7,9,13H,1,3,5-6H2,(H,12,16)(H,14,15) |
| InChIKey | IBBMNXOWLXYFIV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |