C9H15N3O4 — CID 107436041
methyl 2-[(5-oxopiperazine-2-carbonyl)amino]propanoate (PubChem CID 107436041) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is methyl 2-[(5-oxopiperazine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-[(5-oxopiperazine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 107436041 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl 2-[(5-oxopiperazine-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C9H15N3O4/c1-5(9(15)16-2)12-8(14)6-3-11-7(13)4-10-6/h5-6,10H,3-4H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | UNDSJRUIPAIAAX-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |