C14H13N5O2 — CID 107436223
2-[(3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methylamino]acetamide (PubChem CID 107436223) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-[(3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methylamino]acetamide.
| Compound Name | 2-[(3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 107436223 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[(3-quinolin-6-yl-1,2,4-oxadiazol-5-yl)methylamino]acetamide |
| SMILES | NC(=O)CNCc1nc(-c2ccc3ncccc3c2)no1 |
| InChI | InChI=1S/C14H13N5O2/c15-12(20)7-16-8-13-18-14(19-21-13)10-3-4-11-9(6-10)2-1-5-17-11/h1-6,16H,7-8H2,(H2,15,20) |
| InChIKey | OGMALZXGKYWJIE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |