C9H13N5O3 — CID 107440871
ethyl 5-(5-oxopiperazin-2-yl)-1H-1,2,4-triazole-3-carboxylate (PubChem CID 107440871) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is ethyl 5-(5-oxopiperazin-2-yl)-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-(5-oxopiperazin-2-yl)-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 107440871 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | ethyl 5-(5-oxopiperazin-2-yl)-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(C2CNC(=O)CN2)n1 |
| InChI | InChI=1S/C9H13N5O3/c1-2-17-9(16)8-12-7(13-14-8)5-3-11-6(15)4-10-5/h5,10H,2-4H2,1H3,(H,11,15)(H,12,13,14) |
| InChIKey | IMABMPONGCMYLW-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |