C29H33NO5Si — CID 10744100
(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 10744100) has the molecular formula C29H33NO5Si and a molecular weight of 503.67 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10744100 |
| Molecular Formula | C29H33NO5Si |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](O[C@H]1CCN(C(=O)OCc2ccccc2)[C@H]1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO5Si/c1-29(2,3)36(23-15-9-5-10-16-23,24-17-11-6-12-18-24)35-25-19-20-30(26(25)27(31)32)28(33)34-21-22-13-7-4-8-14-22/h4-18,25-26H,19-21H2,1-3H3,(H,31,32)/t25-,26+/m0/s1 |
| InChIKey | DLBWURSMLZBVEW-IZZNHLLZSA-N |
| XLogP | 4.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|