C15H29F3N2O3 — CID 107442252
tert-butyl N-[3-methyl-2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]butyl]carbamate (PubChem CID 107442252) has the molecular formula C15H29F3N2O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]butyl]carbamate |
|---|---|
| PubChem CID | 107442252 |
| Molecular Formula | C15H29F3N2O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]butyl]carbamate |
| SMILES | CC(C)C(CNCCOCC(F)(F)F)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29F3N2O3/c1-11(2)12(9-20-13(21)23-14(3,4)5)8-19-6-7-22-10-15(16,17)18/h11-12,19H,6-10H2,1-5H3,(H,20,21) |
| InChIKey | RKOGIHMCMZQNSW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|