C27H33FN6O3 — CID 10744240
4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-3-N,3-N-dimethylquinoline-3,8-dicarboxamide (PubChem CID 10744240) has the molecular formula C27H33FN6O3 and a molecular weight of 508.60 g/mol. Its IUPAC name is 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-3-N,3-N-dimethylquinoline-3,8-dicarboxamide.
| Compound Name | 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-3-N,3-N-dimethylquinoline-3,8-dicarboxamide |
|---|---|
| PubChem CID | 10744240 |
| Molecular Formula | C27H33FN6O3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 4-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propylamino]-3-N,3-N-dimethylquinoline-3,8-dicarboxamide |
| SMILES | COc1cc(F)ccc1N1CCN(CCCNc2c(C(=O)N(C)C)cnc3c(C(N)=O)cccc23)CC1 |
| InChI | InChI=1S/C27H33FN6O3/c1-32(2)27(36)21-17-31-24-19(6-4-7-20(24)26(29)35)25(21)30-10-5-11-33-12-14-34(15-13-33)22-9-8-18(28)16-23(22)37-3/h4,6-9,16-17H,5,10-15H2,1-3H3,(H2,29,35)(H,30,31) |
| InChIKey | KUHDDXGXESLIIG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|