C12H26N2O — CID 107442860
N'-[2-(2-methylprop-2-enoxy)ethyl]-2-propan-2-ylpropane-1,3-diamine (PubChem CID 107442860) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N'-[2-(2-methylprop-2-enoxy)ethyl]-2-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-[2-(2-methylprop-2-enoxy)ethyl]-2-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107442860 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N'-[2-(2-methylprop-2-enoxy)ethyl]-2-propan-2-ylpropane-1,3-diamine |
| SMILES | C=C(C)COCCNCC(CN)C(C)C |
| InChI | InChI=1S/C12H26N2O/c1-10(2)9-15-6-5-14-8-12(7-13)11(3)4/h11-12,14H,1,5-9,13H2,2-4H3 |
| InChIKey | JLLFPQXJZQSLPV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|