C16H33N3O2 — CID 107442932
tert-butyl 4-[[2-(aminomethyl)-3-methylbutyl]amino]piperidine-1-carboxylate (PubChem CID 107442932) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is tert-butyl 4-[[2-(aminomethyl)-3-methylbutyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(aminomethyl)-3-methylbutyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107442932 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | tert-butyl 4-[[2-(aminomethyl)-3-methylbutyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)C(CN)CNC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33N3O2/c1-12(2)13(10-17)11-18-14-6-8-19(9-7-14)15(20)21-16(3,4)5/h12-14,18H,6-11,17H2,1-5H3 |
| InChIKey | MAMKBWPXIOFJTR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |