About 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol
2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol (PubChem CID 107443077) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol |
| PubChem CID | 107443077 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol |
| SMILES | CC(C)C(CN)C(O)C1=COCCC1 |
| InChI | InChI=1S/C11H21NO2/c1-8(2)10(6-12)11(13)9-4-3-5-14-7-9/h7-8,10-11,13H,3-6,12H2,1-2H3 |
| InChIKey | SNTQTQVPXLIVIG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol?
The IUPAC name of 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol (CID 107443077) is 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol.
What is the SMILES notation for 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol?
The canonical SMILES for 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol is CC(C)C(CN)C(O)C1=COCCC1.
What is the InChIKey of 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol?
The InChIKey is SNTQTQVPXLIVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-8(2)10(6-12)11(13)9-4-3-5-14-7-9/h7-8,10-11,13H,3-6,12H2,1-2H3.
What are the key properties of 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol?
2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol has a molecular weight of 199.29 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1-(3,4-dihydro-2H-pyran-5-yl)-3-methylbutan-1-ol is sourced from PubChem (CID 107443077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).