C23H28O13 — CID 10744326
[(2R,3R,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methoxyphenoxy)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 10744326) has the molecular formula C23H28O13 and a molecular weight of 512.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methoxyphenoxy)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methoxyphenoxy)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10744326 |
| Molecular Formula | C23H28O13 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methoxyphenoxy)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(O)c(C(C)=O)c(O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c1 |
| InChI | InChI=1S/C23H28O13/c1-10(24)19-16(29)7-15(30-6)8-17(19)35-23-22(34-14(5)28)21(33-13(4)27)20(32-12(3)26)18(36-23)9-31-11(2)25/h7-8,18,20-23,29H,9H2,1-6H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | MIOJXZWOLJNJQT-DODNOZFWSA-N |
| XLogP | 1.07 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|