About 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine
2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine (PubChem CID 107443552) has the molecular formula C14H28FN
and a molecular weight of 229.38 g/mol. Its IUPAC name is 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine |
| PubChem CID | 107443552 |
| Molecular Formula | C14H28FN |
| Molecular Weight | 229.38 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine |
| SMILES | CC(C)C(CN)C(F)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H28FN/c1-9(2)13(8-16)14(15)12-6-5-10(3)11(4)7-12/h9-14H,5-8,16H2,1-4H3 |
| InChIKey | UPOYVGLXMNAHLJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine?
The IUPAC name of 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine (CID 107443552) is 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine.
What is the SMILES notation for 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine?
The canonical SMILES for 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine is CC(C)C(CN)C(F)C1CCC(C)C(C)C1.
What is the InChIKey of 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine?
The InChIKey is UPOYVGLXMNAHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28FN/c1-9(2)13(8-16)14(15)12-6-5-10(3)11(4)7-12/h9-14H,5-8,16H2,1-4H3.
What are the key properties of 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine?
2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine has a molecular weight of 229.38 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylcyclohexyl)-fluoromethyl]-3-methylbutan-1-amine is sourced from PubChem (CID 107443552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).