About 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine
2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine (PubChem CID 107443766) has the molecular formula C10H18FNO
and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine |
| PubChem CID | 107443766 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine |
| SMILES | CC(C)C(CN)C(F)C1=CCCO1 |
| InChI | InChI=1S/C10H18FNO/c1-7(2)8(6-12)10(11)9-4-3-5-13-9/h4,7-8,10H,3,5-6,12H2,1-2H3 |
| InChIKey | VTBQLEJOPNVXSP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine?
The IUPAC name of 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine (CID 107443766) is 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine.
What is the SMILES notation for 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine?
The canonical SMILES for 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine is CC(C)C(CN)C(F)C1=CCCO1.
What is the InChIKey of 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine?
The InChIKey is VTBQLEJOPNVXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO/c1-7(2)8(6-12)10(11)9-4-3-5-13-9/h4,7-8,10H,3,5-6,12H2,1-2H3.
What are the key properties of 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine?
2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine has a molecular weight of 187.26 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]-3-methylbutan-1-amine is sourced from PubChem (CID 107443766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).