C16H27N3O — CID 107444694
N'-tert-butyl-N-(4-morpholin-4-ylphenyl)ethane-1,2-diamine (PubChem CID 107444694) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N'-tert-butyl-N-(4-morpholin-4-ylphenyl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-(4-morpholin-4-ylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107444694 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N'-tert-butyl-N-(4-morpholin-4-ylphenyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H27N3O/c1-16(2,3)18-9-8-17-14-4-6-15(7-5-14)19-10-12-20-13-11-19/h4-7,17-18H,8-13H2,1-3H3 |
| InChIKey | UFHICXRVGNPKIT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|