C29H34N4O5 — CID 10744482
7-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-7-oxoheptanoic acid (PubChem CID 10744482) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is 7-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-7-oxoheptanoic acid.
| Compound Name | 7-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 10744482 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 7-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxy-7-oxoheptanoic acid |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)CCCCCC(=O)O)ccc3n(C)c12 |
| InChI | InChI=1S/C29H34N4O5/c1-18-20-12-13-30-27(29(37)31-14-15-32(2)3)22(20)17-23-21-16-19(10-11-24(21)33(4)28(18)23)38-26(36)9-7-5-6-8-25(34)35/h10-13,16-17H,5-9,14-15H2,1-4H3,(H,31,37)(H,34,35) |
| InChIKey | OQJDBJSHLDZQMW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|