About N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine
N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine (PubChem CID 107444839) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine |
| PubChem CID | 107444839 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine |
| SMILES | Cc1n[nH]c(C)c1NCCNC(C)(C)C |
| InChI | InChI=1S/C11H22N4/c1-8-10(9(2)15-14-8)12-6-7-13-11(3,4)5/h12-13H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | LVBDJKZSVVJWAO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine (CID 107444839) is N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine is Cc1n[nH]c(C)c1NCCNC(C)(C)C.
What is the InChIKey of N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine?
The InChIKey is LVBDJKZSVVJWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4/c1-8-10(9(2)15-14-8)12-6-7-13-11(3,4)5/h12-13H,6-7H2,1-5H3,(H,14,15).
What are the key properties of N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine?
N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine has a molecular weight of 210.32 g/mol, XLogP of 1.83, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-N-(3,5-dimethyl-1H-pyrazol-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 107444839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).