C27H38N2O6S — CID 10744487
methyl 4-(naphthalen-2-ylsulfonylmethyl)-5-oxo-5-[[2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]pentanoate (PubChem CID 10744487) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is methyl 4-(naphthalen-2-ylsulfonylmethyl)-5-oxo-5-[[2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]pentanoate.
| Compound Name | methyl 4-(naphthalen-2-ylsulfonylmethyl)-5-oxo-5-[[2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]pentanoate |
|---|---|
| PubChem CID | 10744487 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | methyl 4-(naphthalen-2-ylsulfonylmethyl)-5-oxo-5-[[2-oxo-2-(propan-2-ylamino)ethyl]-pentylamino]pentanoate |
| SMILES | CCCCCN(CC(=O)NC(C)C)C(=O)C(CCC(=O)OC)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H38N2O6S/c1-5-6-9-16-29(18-25(30)28-20(2)3)27(32)23(13-15-26(31)35-4)19-36(33,34)24-14-12-21-10-7-8-11-22(21)17-24/h7-8,10-12,14,17,20,23H,5-6,9,13,15-16,18-19H2,1-4H3,(H,28,30) |
| InChIKey | ZADLOPKMKKCKRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|