C14H22N6 — CID 107444969
N'-tert-butyl-N-[3-(1-methyltetrazol-5-yl)phenyl]ethane-1,2-diamine (PubChem CID 107444969) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-(1-methyltetrazol-5-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[3-(1-methyltetrazol-5-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107444969 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N'-tert-butyl-N-[3-(1-methyltetrazol-5-yl)phenyl]ethane-1,2-diamine |
| SMILES | Cn1nnnc1-c1cccc(NCCNC(C)(C)C)c1 |
| InChI | InChI=1S/C14H22N6/c1-14(2,3)16-9-8-15-12-7-5-6-11(10-12)13-17-18-19-20(13)4/h5-7,10,15-16H,8-9H2,1-4H3 |
| InChIKey | VWCRCAZJKLFFKE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|