C15H25FN2O — CID 107445151
N'-tert-butyl-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine (PubChem CID 107445151) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is N'-tert-butyl-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445151 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N'-tert-butyl-N-[1-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine |
| SMILES | COc1ccc(F)cc1C(C)NCCNC(C)(C)C |
| InChI | InChI=1S/C15H25FN2O/c1-11(17-8-9-18-15(2,3)4)13-10-12(16)6-7-14(13)19-5/h6-7,10-11,17-18H,8-9H2,1-5H3 |
| InChIKey | LMHSGPMVJHRJAQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|