C14H27F3N2O — CID 107445272
N'-tert-butyl-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]ethane-1,2-diamine (PubChem CID 107445272) has the molecular formula C14H27F3N2O and a molecular weight of 296.38 g/mol. Its IUPAC name is N'-tert-butyl-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445272 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N'-tert-butyl-N-[3-(2,2,2-trifluoroethoxy)cyclohexyl]ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H27F3N2O/c1-13(2,3)19-8-7-18-11-5-4-6-12(9-11)20-10-14(15,16)17/h11-12,18-19H,4-10H2,1-3H3 |
| InChIKey | OBNOXMDKPMKUJG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|