About N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine
N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine (PubChem CID 107446638) has the molecular formula C12H21ClFN3
and a molecular weight of 261.77 g/mol. Its IUPAC name is N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine |
| PubChem CID | 107446638 |
| Molecular Formula | C12H21ClFN3 |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine |
| SMILES | Cc1nn(C)c(CC(F)CNC(C)(C)C)c1Cl |
| InChI | InChI=1S/C12H21ClFN3/c1-8-11(13)10(17(5)16-8)6-9(14)7-15-12(2,3)4/h9,15H,6-7H2,1-5H3 |
| InChIKey | PWGFDIXHRAATSG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine?
The IUPAC name of N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine (CID 107446638) is N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine is Cc1nn(C)c(CC(F)CNC(C)(C)C)c1Cl.
What is the InChIKey of N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine?
The InChIKey is PWGFDIXHRAATSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClFN3/c1-8-11(13)10(17(5)16-8)6-9(14)7-15-12(2,3)4/h9,15H,6-7H2,1-5H3.
What are the key properties of N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine?
N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine has a molecular weight of 261.77 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-fluoropropyl]-2-methylpropan-2-amine is sourced from PubChem (CID 107446638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).