C7H10ClN3O2 — CID 107447307
ethyl 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]acetate (PubChem CID 107447307) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is ethyl 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 107447307 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | ethyl 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ncnc1CCl |
| InChI | InChI=1S/C7H10ClN3O2/c1-2-13-7(12)4-11-6(3-8)9-5-10-11/h5H,2-4H2,1H3 |
| InChIKey | IQWPPISNYUKCQW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|