C28H40O10 — CID 10744913
[(1R,2R,3R,5S,7S,8S,9R,10R,13S)-2,9,10-triacetyloxy-5,13-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 10744913) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is [(1R,2R,3R,5S,7S,8S,9R,10R,13S)-2,9,10-triacetyloxy-5,13-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,2R,3R,5S,7S,8S,9R,10R,13S)-2,9,10-triacetyloxy-5,13-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 10744913 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [(1R,2R,3R,5S,7S,8S,9R,10R,13S)-2,9,10-triacetyloxy-5,13-dihydroxy-8,12,15,15-tetramethyl-4-methylidene-7-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](O)C[C@H](OC(C)=O)[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C3=C(C)[C@@H](O)C[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H40O10/c1-12-19(33)10-18-24(36-15(4)30)23-13(2)20(34)11-21(35-14(3)29)28(23,9)26(38-17(6)32)25(37-16(5)31)22(12)27(18,7)8/h18-21,23-26,33-34H,2,10-11H2,1,3-9H3/t18-,19-,20-,21-,23-,24+,25+,26-,28+/m0/s1 |
| InChIKey | FUBMOVYEQAHKMA-WDKHEYHYSA-N |
| XLogP | 2.39 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|