C18H27NO2 — CID 107449378
methyl 1-(3-methylanilino)-3-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 107449378) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is methyl 1-(3-methylanilino)-3-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | methyl 1-(3-methylanilino)-3-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 107449378 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | methyl 1-(3-methylanilino)-3-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(C)c2)CCCC(C(C)C)C1 |
| InChI | InChI=1S/C18H27NO2/c1-13(2)15-8-6-10-18(12-15,17(20)21-4)19-16-9-5-7-14(3)11-16/h5,7,9,11,13,15,19H,6,8,10,12H2,1-4H3 |
| InChIKey | QJCPXJDNJRHCMN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |