About 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol
1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol (PubChem CID 107449696) has the molecular formula C17H29BrN2O
and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol |
| PubChem CID | 107449696 |
| Molecular Formula | C17H29BrN2O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol |
| SMILES | CCc1nn(CC)c(CC2(O)CCCC(C(C)C)C2)c1Br |
| InChI | InChI=1S/C17H29BrN2O/c1-5-14-16(18)15(20(6-2)19-14)11-17(21)9-7-8-13(10-17)12(3)4/h12-13,21H,5-11H2,1-4H3 |
| InChIKey | UNSQWQQFEAUVHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol?
The IUPAC name of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol (CID 107449696) is 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol.
What is the SMILES notation for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol?
The canonical SMILES for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol is CCc1nn(CC)c(CC2(O)CCCC(C(C)C)C2)c1Br.
What is the InChIKey of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol?
The InChIKey is UNSQWQQFEAUVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29BrN2O/c1-5-14-16(18)15(20(6-2)19-14)11-17(21)9-7-8-13(10-17)12(3)4/h12-13,21H,5-11H2,1-4H3.
What are the key properties of 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol?
1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol has a molecular weight of 357.34 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-3-propan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 107449696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).