C13H19BrOS — CID 107449913
1-(3-bromothiophen-2-yl)-3-propan-2-ylcyclohexan-1-ol (PubChem CID 107449913) has the molecular formula C13H19BrOS and a molecular weight of 303.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-3-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-(3-bromothiophen-2-yl)-3-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107449913 |
| Molecular Formula | C13H19BrOS |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-3-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCCC(O)(c2sccc2Br)C1 |
| InChI | InChI=1S/C13H19BrOS/c1-9(2)10-4-3-6-13(15,8-10)12-11(14)5-7-16-12/h5,7,9-10,15H,3-4,6,8H2,1-2H3 |
| InChIKey | PNQDXQVTPAHOOI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |