C15H21F2N — CID 107450086
1-(2,6-difluorophenyl)-3-propan-2-ylcyclohexan-1-amine (PubChem CID 107450086) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-propan-2-ylcyclohexan-1-amine.
| Compound Name | 1-(2,6-difluorophenyl)-3-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 107450086 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCCC(N)(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H21F2N/c1-10(2)11-5-4-8-15(18,9-11)14-12(16)6-3-7-13(14)17/h3,6-7,10-11H,4-5,8-9,18H2,1-2H3 |
| InChIKey | UKMPAQCRHSOPQL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |