C23H32N2O7S2Si — CID 10745019
(4-nitrophenyl)methyl (5R,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylsulfinyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 10745019) has the molecular formula C23H32N2O7S2Si and a molecular weight of 540.74 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylsulfinyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylsulfinyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10745019 |
| Molecular Formula | C23H32N2O7S2Si |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6R)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylsulfinyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(S(C)=O)S[C@H]12 |
| InChI | InChI=1S/C23H32N2O7S2Si/c1-8-16(32-35(6,7)23(2,3)4)17-19(26)24-18(22(34(5)30)33-20(17)24)21(27)31-13-14-9-11-15(12-10-14)25(28)29/h9-12,16-17,20H,8,13H2,1-7H3/t16-,17+,20+,34?/m0/s1 |
| InChIKey | DFYHTZDIGMBLFW-VNMQLNNRSA-N |
| XLogP | 4.52 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|