C26H28AsO3+ — CID 10745094
[(E)-2,4-diethoxy-4-oxobut-2-enyl]-triphenylarsanium (PubChem CID 10745094) has the molecular formula C26H28AsO3+ and a molecular weight of 463.43 g/mol. Its IUPAC name is [(E)-2,4-diethoxy-4-oxobut-2-enyl]-triphenylarsanium.
| Compound Name | [(E)-2,4-diethoxy-4-oxobut-2-enyl]-triphenylarsanium |
|---|---|
| PubChem CID | 10745094 |
| Molecular Formula | C26H28AsO3+ |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [(E)-2,4-diethoxy-4-oxobut-2-enyl]-triphenylarsanium |
| SMILES | CCOC(=O)/C=C(\C[As+](c1ccccc1)(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C26H28AsO3/c1-3-29-25(20-26(28)30-4-2)21-27(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-20H,3-4,21H2,1-2H3/q+1/b25-20+ |
| InChIKey | XLOWAIQWGDMFLL-LKUDQCMESA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|