C13H17FN4 — CID 107451095
N-[[3-(3-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 107451095) has the molecular formula C13H17FN4 and a molecular weight of 248.31 g/mol. Its IUPAC name is N-[[3-(3-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-(3-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107451095 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N-[[3-(3-fluorophenyl)triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cnnn1-c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN4/c1-10(2)7-15-8-13-9-16-17-18(13)12-5-3-4-11(14)6-12/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | XKDIAAWGXABIPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |