C13H14ClF3N4 — CID 107451238
N-[[3-[4-chloro-2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-2-amine (PubChem CID 107451238) has the molecular formula C13H14ClF3N4 and a molecular weight of 318.73 g/mol. Its IUPAC name is N-[[3-[4-chloro-2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[3-[4-chloro-2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107451238 |
| Molecular Formula | C13H14ClF3N4 |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[[3-[4-chloro-2-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cnnn1-c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14ClF3N4/c1-8(2)18-6-10-7-19-20-21(10)12-4-3-9(14)5-11(12)13(15,16)17/h3-5,7-8,18H,6H2,1-2H3 |
| InChIKey | NJTHHMUYGQOPPH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |