C32H38N2O4S — CID 10745170
7-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile (PubChem CID 10745170) has the molecular formula C32H38N2O4S and a molecular weight of 546.73 g/mol. Its IUPAC name is 7-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile.
| Compound Name | 7-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
|---|---|
| PubChem CID | 10745170 |
| Molecular Formula | C32H38N2O4S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 7-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCN2Cc3cc(OC)c(OC)cc3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C32H38N2O4S/c1-23-9-12-27(13-10-23)39-32(22-33,26-11-14-28(35-2)31(19-26)38-5)15-7-6-8-16-34-20-24-17-29(36-3)30(37-4)18-25(24)21-34/h9-14,17-19H,6-8,15-16,20-21H2,1-5H3 |
| InChIKey | WSYQXCUIGUQRGH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|