C14H17BrN4 — CID 107451798
N-[[3-(4-bromo-2-ethylphenyl)triazol-4-yl]methyl]cyclopropanamine (PubChem CID 107451798) has the molecular formula C14H17BrN4 and a molecular weight of 321.22 g/mol. Its IUPAC name is N-[[3-(4-bromo-2-ethylphenyl)triazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(4-bromo-2-ethylphenyl)triazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107451798 |
| Molecular Formula | C14H17BrN4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[[3-(4-bromo-2-ethylphenyl)triazol-4-yl]methyl]cyclopropanamine |
| SMILES | CCc1cc(Br)ccc1-n1nncc1CNC1CC1 |
| InChI | InChI=1S/C14H17BrN4/c1-2-10-7-11(15)3-6-14(10)19-13(9-17-18-19)8-16-12-4-5-12/h3,6-7,9,12,16H,2,4-5,8H2,1H3 |
| InChIKey | QBEFEWMVAMSOLK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |