C10H12FNO2S — CID 107452024
3-(2-aminoethylsulfanylmethyl)-4-fluorobenzoic acid (PubChem CID 107452024) has the molecular formula C10H12FNO2S and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(2-aminoethylsulfanylmethyl)-4-fluorobenzoic acid.
| Compound Name | 3-(2-aminoethylsulfanylmethyl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107452024 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(2-aminoethylsulfanylmethyl)-4-fluorobenzoic acid |
| SMILES | NCCSCc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C10H12FNO2S/c11-9-2-1-7(10(13)14)5-8(9)6-15-4-3-12/h1-2,5H,3-4,6,12H2,(H,13,14) |
| InChIKey | IRAVNINDSBXQAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|