C30H32INO — CID 10745224
[(R)-[(1R,2S)-1-hydroxy-1-naphthalen-1-yl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium iodide (PubChem CID 10745224) has the molecular formula C30H32INO and a molecular weight of 549.50 g/mol. Its IUPAC name is [(R)-[(1R,2S)-1-hydroxy-1-naphthalen-1-yl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium iodide.
| Compound Name | [(R)-[(1R,2S)-1-hydroxy-1-naphthalen-1-yl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 10745224 |
| Molecular Formula | C30H32INO |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | [(R)-[(1R,2S)-1-hydroxy-1-naphthalen-1-yl-3,4-dihydro-2H-naphthalen-2-yl]-phenylmethyl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)[C@@H](c1ccccc1)[C@@H]1CCc2ccccc2[C@@]1(O)c1cccc2ccccc12.[I-] |
| InChI | InChI=1S/C30H32NO.HI/c1-31(2,3)29(24-14-5-4-6-15-24)28-21-20-23-13-8-10-18-26(23)30(28,32)27-19-11-16-22-12-7-9-17-25(22)27;/h4-19,28-29,32H,20-21H2,1-3H3;1H/q+1;/p-1/t28-,29-,30+;/m0./s1 |
| InChIKey | MQMUNJQJSOLSQJ-UIPQRRKWSA-M |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|