About 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine
5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine (PubChem CID 107452871) has the molecular formula C14H26N4S
and a molecular weight of 282.46 g/mol. Its IUPAC name is 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine |
| PubChem CID | 107452871 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine |
| SMILES | CC(C)c1nn(C)c(N2CCSC(C)(C)CC2)c1N |
| InChI | InChI=1S/C14H26N4S/c1-10(2)12-11(15)13(17(5)16-12)18-7-6-14(3,4)19-9-8-18/h10H,6-9,15H2,1-5H3 |
| InChIKey | XIGCMYFQYNGNBB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine?
The IUPAC name of 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine (CID 107452871) is 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine.
What is the SMILES notation for 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine?
The canonical SMILES for 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine is CC(C)c1nn(C)c(N2CCSC(C)(C)CC2)c1N.
What is the InChIKey of 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine?
The InChIKey is XIGCMYFQYNGNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4S/c1-10(2)12-11(15)13(17(5)16-12)18-7-6-14(3,4)19-9-8-18/h10H,6-9,15H2,1-5H3.
What are the key properties of 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine?
5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine has a molecular weight of 282.46 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-methyl-3-propan-2-ylpyrazol-4-amine is sourced from PubChem (CID 107452871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).