About 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline
3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline (PubChem CID 107453067) has the molecular formula C14H22N2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline.
Molecular Properties
| Compound Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline |
| PubChem CID | 107453067 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline |
| SMILES | Cc1cc(N)cc(N2CCSC(C)(C)CC2)c1 |
| InChI | InChI=1S/C14H22N2S/c1-11-8-12(15)10-13(9-11)16-5-4-14(2,3)17-7-6-16/h8-10H,4-7,15H2,1-3H3 |
| InChIKey | XGAXTVVYZVOTLY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline?
The IUPAC name of 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline (CID 107453067) is 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline.
What is the SMILES notation for 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline?
The canonical SMILES for 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline is Cc1cc(N)cc(N2CCSC(C)(C)CC2)c1.
What is the InChIKey of 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline?
The InChIKey is XGAXTVVYZVOTLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2S/c1-11-8-12(15)10-13(9-11)16-5-4-14(2,3)17-7-6-16/h8-10H,4-7,15H2,1-3H3.
What are the key properties of 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline?
3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline has a molecular weight of 250.41 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methylaniline is sourced from PubChem (CID 107453067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).