About 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine
1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine (PubChem CID 107453388) has the molecular formula C15H26N2S2
and a molecular weight of 298.52 g/mol. Its IUPAC name is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine |
| PubChem CID | 107453388 |
| Molecular Formula | C15H26N2S2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine |
| SMILES | Cc1ccc(C(C(C)N)N2CCSC(C)(C)CC2)s1 |
| InChI | InChI=1S/C15H26N2S2/c1-11-5-6-13(19-11)14(12(2)16)17-8-7-15(3,4)18-10-9-17/h5-6,12,14H,7-10,16H2,1-4H3 |
| InChIKey | XNYYPSYYPIJYPO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine?
The IUPAC name of 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine (CID 107453388) is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine.
What is the SMILES notation for 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine?
The canonical SMILES for 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine is Cc1ccc(C(C(C)N)N2CCSC(C)(C)CC2)s1.
What is the InChIKey of 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine?
The InChIKey is XNYYPSYYPIJYPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2S2/c1-11-5-6-13(19-11)14(12(2)16)17-8-7-15(3,4)18-10-9-17/h5-6,12,14H,7-10,16H2,1-4H3.
What are the key properties of 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine?
1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine has a molecular weight of 298.52 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-1-(5-methylthiophen-2-yl)propan-2-amine is sourced from PubChem (CID 107453388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).