About [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine
[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine (PubChem CID 107453908) has the molecular formula C16H32N2OS
and a molecular weight of 300.51 g/mol. Its IUPAC name is [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine.
Molecular Properties
| Compound Name | [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine |
| PubChem CID | 107453908 |
| Molecular Formula | C16H32N2OS |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine |
| SMILES | CCC1(C)CC(CN)(N2CCSC(C)(C)CC2)CCO1 |
| InChI | InChI=1S/C16H32N2OS/c1-5-15(4)12-16(13-17,7-10-19-15)18-8-6-14(2,3)20-11-9-18/h5-13,17H2,1-4H3 |
| InChIKey | YBUBYBUCWNTEAL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The IUPAC name of [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine (CID 107453908) is [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine.
What is the SMILES notation for [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The canonical SMILES for [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine is CCC1(C)CC(CN)(N2CCSC(C)(C)CC2)CCO1.
What is the InChIKey of [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The InChIKey is YBUBYBUCWNTEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2OS/c1-5-15(4)12-16(13-17,7-10-19-15)18-8-6-14(2,3)20-11-9-18/h5-13,17H2,1-4H3.
What are the key properties of [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine?
[4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine has a molecular weight of 300.51 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-ethyl-2-methyloxan-4-yl]methanamine is sourced from PubChem (CID 107453908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).