C17H29FN2 — CID 107454052
N-[[2-fluoro-5-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine (PubChem CID 107454052) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is N-[[2-fluoro-5-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine.
| Compound Name | N-[[2-fluoro-5-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 107454052 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N-[[2-fluoro-5-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine |
| SMILES | CCC(C)N(C)Cc1cc(CNCC(C)C)ccc1F |
| InChI | InChI=1S/C17H29FN2/c1-6-14(4)20(5)12-16-9-15(7-8-17(16)18)11-19-10-13(2)3/h7-9,13-14,19H,6,10-12H2,1-5H3 |
| InChIKey | LAUZDAZPZOFSJV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |